Products 877065-30-0

CAS 877065-30-0 is the registry number for 4-Chloro-3-nitrocinnamic Acid Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 50g, 5g.

Structural formula: {0} (CAS {1})

Methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (CAS 877065-30-0) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate. InChIKey: HQVWYUZVGLAMBS-HWKANZROSA-N.

Identity
Molecular formulaC10H8ClNO4
Molecular weight241.63 g/mol
IUPAC namemethyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate
InChIKeyHQVWYUZVGLAMBS-HWKANZROSA-N
SMILESCOC(=O)/C=C/C1=CC(=C(C=C1)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)