CAS 877065-30-0 is the registry number for 4-Chloro-3-nitrocinnamic Acid Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 50g, 5g.
Methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate (CAS 877065-30-0) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate. InChIKey: HQVWYUZVGLAMBS-HWKANZROSA-N.
| Molecular formula | C10H8ClNO4 |
|---|---|
| Molecular weight | 241.63 g/mol |
| IUPAC name | methyl (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoate |
| InChIKey | HQVWYUZVGLAMBS-HWKANZROSA-N |
| SMILES | COC(=O)/C=C/C1=CC(=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)