Products 236418-11-4

CAS 236418-11-4 is the registry number for 1-(4-Chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid (CAS 236418-11-4) is a chemical compound with the molecular formula C10H8ClNO4 and a molecular weight of 241.63 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid. InChIKey: CCWSKXKFNYZDNP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8ClNO4
Molecular weight241.63 g/mol
IUPAC name1-(4-chloro-3-nitrophenyl)cyclopropane-1-carboxylic acid
InChIKeyCCWSKXKFNYZDNP-UHFFFAOYSA-N
SMILESC1CC1(C2=CC(=C(C=C2)Cl)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)