CAS 1164474-12-7 is the registry number for (2R)-2-(1-Oxo-2,3-dihydro-1H-isoindol-2-yl)-2-phenylacetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetic acid (CAS 1164474-12-7) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: (2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetic acid. InChIKey: PNOHRUSRGMQJPS-CQSZACIVSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (2R)-2-(3-oxo-1H-isoindol-2-yl)-2-phenylacetic acid |
| InChIKey | PNOHRUSRGMQJPS-CQSZACIVSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1[C@H](C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)