CAS 116529-62-5 appears in our catalog under these names: 4-iodo-2-nitrobenzoic acid, 95%, 4-Iodo-2-nitrobenzoic acid, 97%, 4–IODO–2–NITROBENZOIC ACID, 4-iodo-2-nitrobenzoic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 2,5g.
4-iodo-2-nitrobenzoic acid (CAS 116529-62-5) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 4-iodo-2-nitrobenzoic acid. InChIKey: IZBFYNYRKIUGSG-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 4-iodo-2-nitrobenzoic acid |
| InChIKey | IZBFYNYRKIUGSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)