CAS 3861-58-3 appears in our catalog under these names: 4-Hydroxy-3-iodo-5-nitrobenzaldehyde, Levothyroxine Impurity 57. Offered by: TRC, Chemat Brand. Available pack sizes: 1g, on request.
4-hydroxy-3-iodo-5-nitrobenzaldehyde (CAS 3861-58-3) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 4-hydroxy-3-iodo-5-nitrobenzaldehyde. InChIKey: NVMYBVZAFRMSDV-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 4-hydroxy-3-iodo-5-nitrobenzaldehyde |
| InChIKey | NVMYBVZAFRMSDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)I)C=O |
Computed by PubChem (NCBI)