Products 7106-74-3
CAS 7106-74-3 appears in our catalog under these names: 5-Iodo-6-nitro-2H-1,3-benzodioxole, 95%, 5-Iodo-6-nitro-1,3-dioxaindane. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-iodo-6-nitro-1,3-benzodioxole (CAS 7106-74-3) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 5-iodo-6-nitro-1,3-benzodioxole. InChIKey: IHRDPDCTXSIYFC-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 5-iodo-6-nitro-1,3-benzodioxole |
| InChIKey | IHRDPDCTXSIYFC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])I |
Computed by PubChem (NCBI)