Products 35674-27-2
CAS 35674-27-2 appears in our catalog under these names: 4–Iodo–3–nitrobenzoic acid, 4-Iodo-3-nitrobenzoic acid, 4-Iodo-3-nitrobenzoic Acid, >97.0%(GC)(T), 4-iodo-3-nitrobenzoic acid, 97%, 97%, 4-Iodo-3-nitrobenzoic acid, 97%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 250mg, 500g.
4-iodo-3-nitrobenzoic acid (CAS 35674-27-2) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 4-iodo-3-nitrobenzoic acid. InChIKey: DNMTZLCNLAIKQC-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 4-iodo-3-nitrobenzoic acid |
| InChIKey | DNMTZLCNLAIKQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])I |
Computed by PubChem (NCBI)