Products 35674-28-3
CAS 35674-28-3 appears in our catalog under these names: 5–Iodo–2–nitrobenzoic acid, 5-Iodo-2-nitrobenzoic acid, 5-IODO-2-NITROBENZOIC ACID, 97%, 97%, 5-Iodo-2-nitrobenzoic acid, 97%, 5-Iodo-2-nitrobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 2000mg, 1000mg, 1g, 5g.
5-iodo-2-nitrobenzoic acid (CAS 35674-28-3) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 5-iodo-2-nitrobenzoic acid. InChIKey: RYOSQAPCAPOLCV-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 5-iodo-2-nitrobenzoic acid |
| InChIKey | RYOSQAPCAPOLCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)