Products 89459-38-1
CAS 89459-38-1 appears in our catalog under these names: 2-iodo-4-nitrobenzoic acid, 2-Iodo-4-nitrobenzoic acid, 98%, 98%, 2-Iodo-4-nitrobenzoic acid, 95%, 2-Iodo-4-nitrobenzoic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100g.
2-iodo-4-nitrobenzoic acid (CAS 89459-38-1) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 2-iodo-4-nitrobenzoic acid. InChIKey: SQICTGFCQITYDT-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 2-iodo-4-nitrobenzoic acid |
| InChIKey | SQICTGFCQITYDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])I)C(=O)O |
Computed by PubChem (NCBI)