CAS 5398-69-6 appears in our catalog under these names: 2–Iodo–3–nitrobenzoic acid, 2-Iodo-3-nitrobenzoic acid 98%, 2-IODO-3-NITROBENZOIC ACID, 95%, Benzoic acid, 2-iodo-3-nitro-, 98%, 98%, 2-Iodo-3-nitro-benzoic acid, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
2-iodo-3-nitrobenzoic acid (CAS 5398-69-6) is a chemical compound with the molecular formula C7H4INO4 and a molecular weight of 293.02 g/mol. IUPAC name: 2-iodo-3-nitrobenzoic acid. InChIKey: XWOGTRRVKVPJSP-UHFFFAOYSA-N.
| Molecular formula | C7H4INO4 |
|---|---|
| Molecular weight | 293.02 g/mol |
| IUPAC name | 2-iodo-3-nitrobenzoic acid |
| InChIKey | XWOGTRRVKVPJSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])I)C(=O)O |
Computed by PubChem (NCBI)