CAS 116529-78-3 appears in our catalog under these names: 2-Phenylquinolin-8-amine 96%, 2-Phenylquinolin-8-Amine, 96%, 96%, 2-PHENYL-8-AMINOQUINOLINE, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-phenylquinolin-8-amine (CAS 116529-78-3) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-phenylquinolin-8-amine. InChIKey: LOXNFXNXRRMUFJ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-phenylquinolin-8-amine |
| InChIKey | LOXNFXNXRRMUFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC=C3N)C=C2 |
Computed by PubChem (NCBI)