Products 1171575-08-8
CAS 1171575-08-8 is the registry number for 3-(Pyrido[2,3-e]pyrrolo[1,2-a]pyrazin-6-ylthio)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)propanoic acid (CAS 1171575-08-8) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 3-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)propanoic acid. InChIKey: URPZXBUEOZOBIS-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 3-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-ylsulfanyl)propanoic acid |
| InChIKey | URPZXBUEOZOBIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)N=C(C3=CC=CN23)SCCC(=O)O |
Computed by PubChem (NCBI)