CAS 893645-77-7 is the registry number for 1,3-Dimethyl-6-thien-2-yl-1h-pyrazolo[3,4-b]pyridine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 893645-77-7) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: SFWLLQXTTFBYMQ-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 1,3-dimethyl-6-thiophen-2-ylpyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | SFWLLQXTTFBYMQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3=CC=CS3)C(=O)O)C |
Computed by PubChem (NCBI)