CAS 941868-60-6 is the registry number for 7-(4-Methoxyphenyl)-2-methyl(1,3)thiazolo(4,5-d)pyridazin-4(5H)-one. Offered by: TRC. Available pack sizes: 1g.
7-(4-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one (CAS 941868-60-6) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 7-(4-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one. InChIKey: FEFQMQTWRHXCPW-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 7-(4-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| InChIKey | FEFQMQTWRHXCPW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=NNC2=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)