CAS 941868-58-2 appears in our catalog under these names: 7-(3-Methoxyphenyl)-2-methylthiazolo[4,5-d]pyridazin-4(5H)-one, 98%, 7-(3-Methoxyphenyl)-2-methyl(1,3)thiazolo(4,5-d)pyridazin-4(5h)-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
7-(3-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one (CAS 941868-58-2) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 7-(3-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one. InChIKey: NWVOVKSSPQJRJZ-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 7-(3-methoxyphenyl)-2-methyl-5H-[1,3]thiazolo[4,5-d]pyridazin-4-one |
| InChIKey | NWVOVKSSPQJRJZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C(=NNC2=O)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)