CAS 937606-30-9 is the registry number for 2-(3-Methyl-4-(thiophen-2-yl)-1H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3-methyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridin-1-yl)acetic acid (CAS 937606-30-9) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 2-(3-methyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridin-1-yl)acetic acid. InChIKey: VNZIIVXFSBNUIU-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 2-(3-methyl-4-thiophen-2-ylpyrazolo[3,4-b]pyridin-1-yl)acetic acid |
| InChIKey | VNZIIVXFSBNUIU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=CC(=C12)C3=CC=CS3)CC(=O)O |
Computed by PubChem (NCBI)