CAS 1365962-18-0 is the registry number for 4-(Methylthio)-2-phenyl-1h-pyrazolo[4,3-c]pyridine-3,6(2h,5h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methylsulfanyl-2-phenyl-1,5-dihydropyrazolo[4,3-c]pyridine-3,6-dione (CAS 1365962-18-0) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 4-methylsulfanyl-2-phenyl-1,5-dihydropyrazolo[4,3-c]pyridine-3,6-dione. InChIKey: VRLUEYOKDGDLRU-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 4-methylsulfanyl-2-phenyl-1,5-dihydropyrazolo[4,3-c]pyridine-3,6-dione |
| InChIKey | VRLUEYOKDGDLRU-UHFFFAOYSA-N |
| SMILES | CSC1=C2C(=CC(=O)N1)NN(C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)