Products 1312020-01-1
CAS 1312020-01-1 is the registry number for 1-(Phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-5-amine (CAS 1312020-01-1) is a chemical compound with the molecular formula C13H11N3O2S and a molecular weight of 273.31 g/mol. IUPAC name: 1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-5-amine. InChIKey: QMBNNLRNNFRGCC-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-5-amine |
| InChIKey | QMBNNLRNNFRGCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=CN=C32)N |
Computed by PubChem (NCBI)