Products 1185878-99-2
CAS 1185878-99-2 is the registry number for 7-Methylxanthine-d3, 99.31%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
7-(trideuteriomethyl)-3H-purine-2,6-dione (CAS 1185878-99-2) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 169.16 g/mol. IUPAC name: 7-(trideuteriomethyl)-3H-purine-2,6-dione. InChIKey: PFWLFWPASULGAN-FIBGUPNXSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | 7-(trideuteriomethyl)-3H-purine-2,6-dione |
| InChIKey | PFWLFWPASULGAN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)