CAS 117391-56-7 appears in our catalog under these names: 3-Amino-3-(2,3-dichlorophenyl)propanoic acid, 95%, H-β-DL-Phe(2,3-DiCl)-OH 98%, 3-Amino-3-(2,3-dichlorophenyl)propanoic acid, 98%, 98%, 3-Amino-3-(2,3-dichlorophenyl)propanoic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
3-amino-3-(2,3-dichlorophenyl)propanoic acid (CAS 117391-56-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 3-amino-3-(2,3-dichlorophenyl)propanoic acid. InChIKey: GQKLESLYMHWBOP-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3-amino-3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | GQKLESLYMHWBOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(CC(=O)O)N |
Computed by PubChem (NCBI)