CAS 743416-09-3 is the registry number for (R)–3–Amino–3–(2,3–dichlorophenyl)–propionic acid. Offered by: GLPBio. Available pack sizes: 250mg.
(3R)-3-amino-3-(2,3-dichlorophenyl)propanoic acid (CAS 743416-09-3) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (3R)-3-amino-3-(2,3-dichlorophenyl)propanoic acid. InChIKey: GQKLESLYMHWBOP-SSDOTTSWSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(2,3-dichlorophenyl)propanoic acid |
| InChIKey | GQKLESLYMHWBOP-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)