Products 1174311-58-0

CAS 1174311-58-0 is the registry number for 3(4H)-Quinazolinepropanoic acid, 4-oxo-, hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 10g.

3-(4-oxoquinazolin-3-yl)propanoic acid;hydrochloride (CAS 1174311-58-0) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 3-(4-oxoquinazolin-3-yl)propanoic acid;hydrochloride. InChIKey: XADGWNPBBOBRJK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClN2O3
Molecular weight254.67 g/mol
IUPAC name3-(4-oxoquinazolin-3-yl)propanoic acid;hydrochloride
InChIKeyXADGWNPBBOBRJK-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C=N2)CCC(=O)O.Cl

Computed by PubChem (NCBI)