Products 1174851-74-1

CAS 1174851-74-1 is the registry number for 5-((2,2,2-Trifluoroethoxy)methyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(2,2,2-trifluoroethoxymethyl)thiophene-2-carboxylic acid (CAS 1174851-74-1) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: 5-(2,2,2-trifluoroethoxymethyl)thiophene-2-carboxylic acid. InChIKey: DACKXUFQJWUSHS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7F3O3S
Molecular weight240.20 g/mol
IUPAC name5-(2,2,2-trifluoroethoxymethyl)thiophene-2-carboxylic acid
InChIKeyDACKXUFQJWUSHS-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)C(=O)O)COCC(F)(F)F

Computed by PubChem (NCBI)