CAS 339-48-0 is the registry number for 2,2,2-Trifluoroethyl benzenesulfonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,2,2-trifluoroethyl benzenesulfonate (CAS 339-48-0) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: 2,2,2-trifluoroethyl benzenesulfonate. InChIKey: ABRHGSTXPVUNBK-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl benzenesulfonate |
| InChIKey | ABRHGSTXPVUNBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)