CAS 1274903-38-6 appears in our catalog under these names: 3-(Trifluoromethylsulfonyl)benzyl alcohol, 95%, 3-(Trifluoromethylsulphonyl)benzyl alcohol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[3-(trifluoromethylsulfonyl)phenyl]methanol (CAS 1274903-38-6) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: [3-(trifluoromethylsulfonyl)phenyl]methanol. InChIKey: WWMBYRXFWHZGDQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | [3-(trifluoromethylsulfonyl)phenyl]methanol |
| InChIKey | WWMBYRXFWHZGDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)C(F)(F)F)CO |
Computed by PubChem (NCBI)