CAS 87750-51-4 appears in our catalog under these names: 4-(Trifluoromethoxy)phenyl methyl sulfone, 1-(Methylsulfonyl)-4-(trifluoromethoxy)benzene, 98%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 10g, 5g, 25g.
1-methylsulfonyl-4-(trifluoromethoxy)benzene (CAS 87750-51-4) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: 1-methylsulfonyl-4-(trifluoromethoxy)benzene. InChIKey: FNXVEILQGNGZNE-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | 1-methylsulfonyl-4-(trifluoromethoxy)benzene |
| InChIKey | FNXVEILQGNGZNE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)OC(F)(F)F |
Computed by PubChem (NCBI)