CAS 37903-93-8 appears in our catalog under these names: 4-(Trifluoromethyl)phenyl methanesulfonate, 95%, 4-(Trifluoromethyl)phenyl methanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[4-(trifluoromethyl)phenyl] methanesulfonate (CAS 37903-93-8) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl] methanesulfonate. InChIKey: USSPAXCYRHZSFF-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl] methanesulfonate |
| InChIKey | USSPAXCYRHZSFF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)