CAS 219872-98-7 is the registry number for 4-(Trifluoromethylsulfonyl)benzyl Alcohol. Offered by: TRC. Available pack sizes: 500mg.
[4-(trifluoromethylsulfonyl)phenyl]methanol (CAS 219872-98-7) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: [4-(trifluoromethylsulfonyl)phenyl]methanol. InChIKey: WRMBATBCNBSFFR-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | [4-(trifluoromethylsulfonyl)phenyl]methanol |
| InChIKey | WRMBATBCNBSFFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)