CAS 32578-31-7 is the registry number for m-Tolyl trifluoromethanesulfonate, 98%. Offered by: Fluorochem. Available pack sizes: 5g.
(3-methylphenyl) trifluoromethanesulfonate (CAS 32578-31-7) is a chemical compound with the molecular formula C8H7F3O3S and a molecular weight of 240.20 g/mol. IUPAC name: (3-methylphenyl) trifluoromethanesulfonate. InChIKey: JKQWRNLLUVAYLV-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3S |
|---|---|
| Molecular weight | 240.20 g/mol |
| IUPAC name | (3-methylphenyl) trifluoromethanesulfonate |
| InChIKey | JKQWRNLLUVAYLV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)