CAS 1174906-82-1 appears in our catalog under these names: 1-Ethyl-4-nitro-1H-pyrazole-3-carboxamide, 1-Ethyl-4-nitro-1H-pyrazole-3-carboxamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
1-ethyl-4-nitropyrazole-3-carboxamide (CAS 1174906-82-1) is a chemical compound with the molecular formula C6H8N4O3 and a molecular weight of 184.15 g/mol. IUPAC name: 1-ethyl-4-nitropyrazole-3-carboxamide. InChIKey: RIWSEYIPUTZQBS-UHFFFAOYSA-N.
| Molecular formula | C6H8N4O3 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 1-ethyl-4-nitropyrazole-3-carboxamide |
| InChIKey | RIWSEYIPUTZQBS-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)