Products 1175300-57-8
CAS 1175300-57-8 is the registry number for 2-Chloro-α-cyclopropyl-3,6-difluorobenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-chloro-3,6-difluorophenyl)-cyclopropylmethanol (CAS 1175300-57-8) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: (2-chloro-3,6-difluorophenyl)-cyclopropylmethanol. InChIKey: HSXRCJLQWLXOFK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | (2-chloro-3,6-difluorophenyl)-cyclopropylmethanol |
| InChIKey | HSXRCJLQWLXOFK-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=CC(=C2Cl)F)F)O |
Computed by PubChem (NCBI)