Products 145299-85-0
CAS 145299-85-0 appears in our catalog under these names: 1-Chloro-1,1-difluoro-4-phenylbutan-2-one, 95%, 1-Chloro-1,1-difluoro-4-phenylbutan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-chloro-1,1-difluoro-4-phenylbutan-2-one (CAS 145299-85-0) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 1-chloro-1,1-difluoro-4-phenylbutan-2-one. InChIKey: SZMFMSBWDKHDTJ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 1-chloro-1,1-difluoro-4-phenylbutan-2-one |
| InChIKey | SZMFMSBWDKHDTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)