CAS 2140413-51-8 is the registry number for 1-(4-chloro-2-methylphenyl)-2,2-difluoropropan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(4-chloro-2-methylphenyl)-2,2-difluoropropan-1-one (CAS 2140413-51-8) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 1-(4-chloro-2-methylphenyl)-2,2-difluoropropan-1-one. InChIKey: COZYCJZIZKPESZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 1-(4-chloro-2-methylphenyl)-2,2-difluoropropan-1-one |
| InChIKey | COZYCJZIZKPESZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(=O)C(C)(F)F |
Computed by PubChem (NCBI)