CAS 1352208-49-1 is the registry number for 2-chloro-1-(2-ethylphenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-chloro-1-(2-ethylphenyl)-2,2-difluoroethanone (CAS 1352208-49-1) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 2-chloro-1-(2-ethylphenyl)-2,2-difluoroethanone. InChIKey: PAZUIKKHMSVESL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 2-chloro-1-(2-ethylphenyl)-2,2-difluoroethanone |
| InChIKey | PAZUIKKHMSVESL-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC=C1C(=O)C(F)(F)Cl |
Computed by PubChem (NCBI)