CAS 1956307-36-0 is the registry number for 4-(4-Chloro-2,6-difluorophenyl)butan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-(4-chloro-2,6-difluorophenyl)butan-2-one (CAS 1956307-36-0) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 4-(4-chloro-2,6-difluorophenyl)butan-2-one. InChIKey: LBOOSJMPRCPJFS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 4-(4-chloro-2,6-difluorophenyl)butan-2-one |
| InChIKey | LBOOSJMPRCPJFS-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=C(C=C(C=C1F)Cl)F |
Computed by PubChem (NCBI)