Products 2918887-95-1
CAS 2918887-95-1 is the registry number for 1-(3-chloro-2,4-difluorophenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chloro-2,4-difluorophenyl)cyclobutan-1-ol (CAS 2918887-95-1) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 1-(3-chloro-2,4-difluorophenyl)cyclobutan-1-ol. InChIKey: PSSKJHQSJZXVPS-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 1-(3-chloro-2,4-difluorophenyl)cyclobutan-1-ol |
| InChIKey | PSSKJHQSJZXVPS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C(=C(C=C2)F)Cl)F)O |
Computed by PubChem (NCBI)