CAS 1694461-43-2 is the registry number for 1-(4-Chloro-2,5-dimethylphenyl)-2,2-difluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-chloro-2,5-dimethylphenyl)-2,2-difluoroethanone (CAS 1694461-43-2) is a chemical compound with the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. IUPAC name: 1-(4-chloro-2,5-dimethylphenyl)-2,2-difluoroethanone. InChIKey: ZATTVYAMGJKFBO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2O |
|---|---|
| Molecular weight | 218.63 g/mol |
| IUPAC name | 1-(4-chloro-2,5-dimethylphenyl)-2,2-difluoroethanone |
| InChIKey | ZATTVYAMGJKFBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)C(=O)C(F)F |
Computed by PubChem (NCBI)