CAS 117620-77-6 appears in our catalog under these names: 3-Cyano-7-ethoxycoumarin, >95% (HPLC), 3–Cyano–7–ethoxycoumarin, 3-Cyano-7-ethoxycoumarin/ 100%, 3-Cyano-7-ethoxycoumarin, 3-Cyano-7-ethoxycoumarin 98%. Offered by: TRC, GLPBio, TargetMol, Chemat, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 20mg, 250mg, 500mg, 1000mg.
7-ethoxy-2-oxochromene-3-carbonitrile (CAS 117620-77-6) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 7-ethoxy-2-oxochromene-3-carbonitrile. InChIKey: YAFGHMIAFYQSCF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 7-ethoxy-2-oxochromene-3-carbonitrile |
| InChIKey | YAFGHMIAFYQSCF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C(=O)O2)C#N |
Computed by PubChem (NCBI)