CAS 1176714-94-5 is the registry number for 5-Amino-2-methyl-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-amino-2-methyl-4H-1,4-benzoxazin-3-one (CAS 1176714-94-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 5-amino-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: IZKPTNINVYYROO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-amino-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | IZKPTNINVYYROO-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(C=CC=C2O1)N |
Computed by PubChem (NCBI)