CAS 1176721-71-3 appears in our catalog under these names: 2-((2-Fluorophenyl)amino)-1,3-thiazole-4-carboxylic acid, 2-[(2-Fluorophenyl)amino]-4-thiazolecarboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 10000mg, 5000mg, 100mg, 250mg, 1g.
2-(2-fluoroanilino)-1,3-thiazole-4-carboxylic acid (CAS 1176721-71-3) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: NMJJOYBVZJHOQK-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(2-fluoroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | NMJJOYBVZJHOQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)