Products 762287-54-7
CAS 762287-54-7 appears in our catalog under these names: 2-((4-Fluorophenyl)amino)thiazole-5-carboxylic acid, 95%, 95%, 2-((4-Fluorophenyl)amino)thiazole-5-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-fluoroanilino)-1,3-thiazole-5-carboxylic acid (CAS 762287-54-7) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-fluoroanilino)-1,3-thiazole-5-carboxylic acid. InChIKey: ASEPYNUZTFPXIL-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-fluoroanilino)-1,3-thiazole-5-carboxylic acid |
| InChIKey | ASEPYNUZTFPXIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)