Products 2137958-44-0
CAS 2137958-44-0 is the registry number for 5-(3-Fluoro-4-nitrophenyl)-3-methyl-isothiazole. Offered by: TRC. Available pack sizes: 2,5g.
5-(3-fluoro-4-nitrophenyl)-3-methyl-1,2-thiazole (CAS 2137958-44-0) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: 5-(3-fluoro-4-nitrophenyl)-3-methyl-1,2-thiazole. InChIKey: HXHWHJLDVXNJTE-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 5-(3-fluoro-4-nitrophenyl)-3-methyl-1,2-thiazole |
| InChIKey | HXHWHJLDVXNJTE-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=C1)C2=CC(=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)