Products 1545838-19-4
CAS 1545838-19-4 is the registry number for Methyl 2-(5-fluoropyridin-2-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(5-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylate (CAS 1545838-19-4) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: methyl 2-(5-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylate. InChIKey: MFHZVXHJQLTVCG-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | methyl 2-(5-fluoro-2-pyridinyl)-1,3-thiazole-4-carboxylate |
| InChIKey | MFHZVXHJQLTVCG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=NC=C(C=C2)F |
Computed by PubChem (NCBI)