Products 1551674-22-6
CAS 1551674-22-6 is the registry number for Methyl 2-(3-fluoropyridin-4-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(3-fluoro-4-pyridinyl)-1,3-thiazole-4-carboxylate (CAS 1551674-22-6) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: methyl 2-(3-fluoro-4-pyridinyl)-1,3-thiazole-4-carboxylate. InChIKey: PFMUUTOGDNNSII-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | methyl 2-(3-fluoro-4-pyridinyl)-1,3-thiazole-4-carboxylate |
| InChIKey | PFMUUTOGDNNSII-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=C(C=NC=C2)F |
Computed by PubChem (NCBI)