Products 1697939-35-7
CAS 1697939-35-7 appears in our catalog under these names: 2-Fluoro-4-((1,3-thiazol-2-yl)amino)benzoic acid, 95%, 2-Fluoro-4-((1,3-thiazol-2-yl)amino)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid (CAS 1697939-35-7) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid. InChIKey: PBWKJVXSTLIJRV-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid |
| InChIKey | PBWKJVXSTLIJRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC=CS2)F)C(=O)O |
Computed by PubChem (NCBI)