CAS 887405-91-6 is the registry number for 2-((4-Fluorophenyl)amino)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 10000mg.
2-(4-fluoroanilino)-1,3-thiazole-4-carboxylic acid (CAS 887405-91-6) is a chemical compound with the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. IUPAC name: 2-(4-fluoroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: LMPVEGRCFNNGAH-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O2S |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(4-fluoroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | LMPVEGRCFNNGAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=CS2)C(=O)O)F |
Computed by PubChem (NCBI)