CAS 1176784-51-2 appears in our catalog under these names: Carbidopa Impurity 16, 3-Methyl-6,7-cinnolinediol. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-methylcinnoline-6,7-diol (CAS 1176784-51-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methylcinnoline-6,7-diol. InChIKey: ITGJFKRFEQQFAX-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methylcinnoline-6,7-diol |
| InChIKey | ITGJFKRFEQQFAX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(C=C2N=N1)O)O |
Computed by PubChem (NCBI)