CAS 1177273-68-5 appears in our catalog under these names: N-(2-Furylmethyl)-1,3-thiazol-2-amine hydrochloride, 95%, N-(Furan-2-ylmethyl)thiazol-2-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
N-(furan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride (CAS 1177273-68-5) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: N-(furan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: USMYACZFCOKNCP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | USMYACZFCOKNCP-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=NC=CS2.Cl |
Computed by PubChem (NCBI)