CAS 634198-62-2 is the registry number for 6-Amino-2H-benzo[b][1,4]thiazin-3(4H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-4H-1,4-benzothiazin-3-one;hydrochloride (CAS 634198-62-2) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: 6-amino-4H-1,4-benzothiazin-3-one;hydrochloride. InChIKey: AZRSYJQLWLFMBI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | 6-amino-4H-1,4-benzothiazin-3-one;hydrochloride |
| InChIKey | AZRSYJQLWLFMBI-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)