Products 1820705-08-5
CAS 1820705-08-5 is the registry number for (5-Chloro-2-hydroxy-4-methylphenyl)thiourea, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(5-chloro-2-hydroxy-4-methylphenyl)thiourea (CAS 1820705-08-5) is a chemical compound with the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. IUPAC name: (5-chloro-2-hydroxy-4-methylphenyl)thiourea. InChIKey: PXGZHALEUIZUOR-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2OS |
|---|---|
| Molecular weight | 216.69 g/mol |
| IUPAC name | (5-chloro-2-hydroxy-4-methylphenyl)thiourea |
| InChIKey | PXGZHALEUIZUOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)NC(=S)N)O |
Computed by PubChem (NCBI)